BETA-LAPACHONE
Catalog No: FT-0635405
CAS No: 4707-32-8
- Chemical Name: BETA-LAPACHONE
- Molecular Formula: C15H14O3
- Molecular Weight: 242.27
- InChI Key: QZPQTZZNNJUOLS-UHFFFAOYSA-N
- InChI: InChI=1S/C15H14O3/c1-15(2)8-7-11-13(17)12(16)9-5-3-4-6-10(9)14(11)18-15/h3-6H,7-8H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | >110ºC (dec.) |
|---|---|
| CAS: | 4707-32-8 |
| MF: | C15H14O3 |
| Flash_Point: | 169.7±27.9 °C |
| Product_Name: | β-lapachone |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 242.270 |
| Bolling_Point: | 381.4±42.0 °C at 760 mmHg |
| Melting_Point: | >110ºC (dec.) |
|---|---|
| Refractive_Index: | 1.595 |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| MF: | C15H14O3 |
| Flash_Point: | 169.7±27.9 °C |
| LogP: | 2.82 |
| FW: | 242.270 |
| Density: | 1.3±0.1 g/cm3 |
| PSA: | 43.37000 |
| Bolling_Point: | 381.4±42.0 °C at 760 mmHg |
| Exact_Mass: | 242.094299 |
| RTECS: | QL6127400 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2914399090 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)